Glycine hydrate sodium salt
sodium aminoacetate hydrate (1:1:1)
CAS: 313222-98-9
Molecular Formula: H2NCH2CO2NaxH2O
Glycine hydrate sodium salt - Names and Identifiers
| Name | sodium aminoacetate hydrate (1:1:1) |
| Synonyms | sodiuM 2-aMinoacetate hydrate Glycine hydrate sodium salt GLYCINE SODIUM SALT HYDRATE 98 |
| CAS | 313222-98-9 |
| InChI | InChI=1/C2H5NO2.Na.H2O/c3-1-2(4)5;;/h1,3H2,(H,4,5);;1H2/q;+1;/p-1 |
Glycine hydrate sodium salt - Physico-chemical Properties
| Molecular Formula | H2NCH2CO2NaxH2O |
| Molar Mass | 97.05 |
| Melting Point | 197-201°C(lit.) |
Glycine hydrate sodium salt - Risk and Safety
| WGK Germany | 3 |
Glycine hydrate sodium salt - Introduction
The formula of sodium aminoacetate hydrate (1:1:1) is C2H4NNaO3 • H2O. The following is an introduction to the nature, use, formulation and safety information of sodium aminoacetate hydrate (1:1:1):
Nature:
1. Appearance: colorless crystalline powder.
2. Solubility: Soluble in water, slightly soluble in alcohols.
3. Ph value: neutral in water.
4. Melting point: About 230 ° C.
Use:
1. Medical field: sodium aminoacetate hydrate (1:1:1) is commonly used as a formula component of normal saline, which can be used to maintain the balance of tissue fluid and treat dehydration.
2. Food and beverage industry: sodium aminoacetate hydrate (1:1:1) is used as a flavoring agent and thickener.
3. Cosmetics and personal care products: used as skin moisturizer and conditioner.
Method:
sodium aminoacetate hydrate (1:1:1) can be obtained by dissolving glycine in water, then reacting with sodium hydroxide, and finally crystallizing.
Safety Information:
1. sodium aminoacetate hydrate (1:1:1) is non-toxic to the human body under general conditions, but should avoid contact with skin or eyes.
2. During use, you should wear appropriate personal protective equipment, such as gloves and glasses.
3. During storage, sodium aminoacetate hydrate (1:1:1) should be placed in a dry, dark environment, away from fire and oxidizing agents.
4. If accidental exposure or ingestion, seek medical attention immediately.
Nature:
1. Appearance: colorless crystalline powder.
2. Solubility: Soluble in water, slightly soluble in alcohols.
3. Ph value: neutral in water.
4. Melting point: About 230 ° C.
Use:
1. Medical field: sodium aminoacetate hydrate (1:1:1) is commonly used as a formula component of normal saline, which can be used to maintain the balance of tissue fluid and treat dehydration.
2. Food and beverage industry: sodium aminoacetate hydrate (1:1:1) is used as a flavoring agent and thickener.
3. Cosmetics and personal care products: used as skin moisturizer and conditioner.
Method:
sodium aminoacetate hydrate (1:1:1) can be obtained by dissolving glycine in water, then reacting with sodium hydroxide, and finally crystallizing.
Safety Information:
1. sodium aminoacetate hydrate (1:1:1) is non-toxic to the human body under general conditions, but should avoid contact with skin or eyes.
2. During use, you should wear appropriate personal protective equipment, such as gloves and glasses.
3. During storage, sodium aminoacetate hydrate (1:1:1) should be placed in a dry, dark environment, away from fire and oxidizing agents.
4. If accidental exposure or ingestion, seek medical attention immediately.
Last Update：2024-04-09 02:00:45
